0
S(CH3)2 is the formula for Dimethyl Sulfide analogous to Dimethyl ether
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
What is formula or equation of euler's critical load?
Fcr=pi^2*E*I/((KL)^2
What is the formula in computing force?
The equation for force (F) is mass (m) multiplied by acceleration (a). In SI units force is measured in Newtons (N), while 'm' is in kilograms and 'a' is in meters per second per second (m/s^2).
Formula in a full mesh network?
Where n = number of nodes The number of connections in a full mesh = n(n - 1) / 2
What is nyquist Channel capacity formula?
C = 2*B*log2(M) where C --> capacity B --> bandwidth M --> # of discrete signals
Formula to determining the connections in a full mesh network?
Where n = number of nodes The number of connections in a full mesh = n(n - 1) / 2
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
what is the formula for "2-bromo-2-methylpropane + H2O →2-methylpropan-2-ol + HBr"?
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr
What is The chemical formula of trimethylsulfonium iodide?
Formula: [S(CH3)3]I
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
What is the structural formula of 2-ethyl hexane?
CH3-CH=CH2-CH2-CH2-CH3 CH3
What is the chemical formula for Bisphenol A?
The formula is: (CH3)2C(C6H4OH)2
What is condensed formula for 2 3 3 4 tetramethylnonane?
Ch3ch(ch3)c(ch3)2ch(ch3)(ch2)4ch3
What is the Structural formula of 3-chloro-2-methylpentane?
Ch3ch2ch(ch3)ch2ch=o
Structural formula of CH3-CH equals CH-CO-H?
This is already a structural formula CH3-CH=CH-CHO of 2- butenal or Butanal-2-en
What is the empirical formula of dimethylhydrazine?
C2H8N2 is molecular formula so empirical formula is C1H4N1
What 2 organic chemicals have the formula C2H6O?
Ethanol is C2H5OH and dimethyl ether is CH3-O-CH3. Both are C2H6O.
Structural formula of acetone?
Acetone (2-propanone, propanone, or other names) has CH3COCH3 as its chemical formula. But it shares that formula with propionaldehyde (propanal). The two chemicals are structural isomers, and they have clearly different chemical properties. That's why we have a scheme for the structural formula of an organic compound. Since we can't "draw" here, use the link to a nice picture of the structural formula of acetone. The information is provided by our friends at Wikipedia, where knowledge is free.
