0
What else can I help you with?
What is formula or equation of euler's critical load?
Fcr=pi^2*E*I/((KL)^2
What is the recursive formula for the function f(n) where f(n) is defined as f(n) (f(n/2))?
The recursive formula for the function f(n) is f(n) f(n/2).
What is the formula in computing force?
The equation for force (F) is mass (m) multiplied by acceleration (a). In SI units force is measured in Newtons (N), while 'm' is in kilograms and 'a' is in meters per second per second (m/s^2).
How to find the 2's complement of a binary number?
To find the 2's complement of a binary number, invert all the bits and add 1 to the result.
How to perform 2's complement conversion?
To perform 2's complement conversion, invert all the bits in the binary number and then add 1 to the result.
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
what is the formula for "2-bromo-2-methylpropane + H2O →2-methylpropan-2-ol + HBr"?
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr
What is The chemical formula of trimethylsulfonium iodide?
Formula: [S(CH3)3]I
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the extended structural formula of 2-methyl propane?
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
What is the displayed formula of 2-methylpentane?
The displayed formula of 2-methylpentane can be represented as follows: CH3 | CH3-CH-CH2-CH3 In this structure, a methyl (CH3) group is attached to the second carbon of a five-carbon straight-chain alkane (pentane). The full molecular formula for 2-methylpentane is C6H14.
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is the condensed formula for 223trimethylpentane?
The condensed formula for 2,2,3-trimethylpentane is CH₃C(CH₃)₂CH(CH₃)₂CH₃.
What is the chemical formula for Bisphenol A?
The formula is: (CH3)2C(C6H4OH)2
What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?
The condensed structural formula for 3-ethyl-2,5-dimethyloctane is CH3CH(CH2CH3)CH(CH3)C(CH3)2CH2CH2CH3.
What is the formula of methyl ether?
Ch3 -o- ch3
What is 2-2-4-4-tetramethylpentane?
2,2,4,4-tetramethylpentane is a branched-chain hydrocarbon with the chemical formula C9H22. It is commonly used as a reference compound in gas chromatography because of its unique structure and boiling point.
