answersLogoWhite

0

Mix it slowly in a glass, HDPE, or stainless container and use all safety equipment (gloves, eyewear, and ventilation). Always add powder to the liquid and if it gets hot to the touch, slow down.

Both chemicals absorb water from the atmosphere, so choose your location and the day appropriately.

User Avatar

Wiki User

18y ago

What else can I help you with?

Continue Learning about Earth Science

What would you expect to happen if sodium methoxide were added to water?

When sodium methoxide is added to water, it will undergo hydrolysis, producing sodium hydroxide and methanol. This reaction releases heat and sodium hydroxide is a strong base that can cause skin and eye irritation. Extreme care should be taken when handling sodium methoxide as it is highly reactive.


Why should sodium methoxide 25 percent in methanol be kept tightly closed when not in use?

Firstly, sodium methoxide is extremely toxic, so you want to handle it carefully without ever spilling (e.g. from an unsealed container). Secondly, methanol is hygroscopic and will pick up lots of water from the atmosphere. Water will hydrolyze sodium methoxide into methanol and sodium hydroxide. You wouldn't want your methanol to evaporate either.


What is the equation of 2 iodohexane with sodium methoxide?

The reaction between 2-iodohexane and sodium methoxide will result in the substitution of the iodine atom by the methoxy group. The product formed will be 2-methoxyhexane. The equation for the reaction is 2-iodohexane + sodium methoxide -> 2-methoxyhexane + sodium iodide.


Would the alkoxide form if an hydroxide was dissolved in methanol?

No. Alkoxide ions are stronger bases than hydroxide ions. The only way of making an alkoxide is by reacting a hihgly reactive metal such as sodium with the corresponding alcohol (react sodium with methanol to produce sodium methoxide). In water sodium methoxide will react to produce sodium hydroxide and methanol.


What is the equation of 2 iodohexane with sodium methoixde?

CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI

Related Questions

Is sodium methoxide solution soluble in toluene?

Preperation ofIsoxazole Ester by using sodium methoxide, diethyl oxalate and ...


What is the reaction between Hydrazoic acid and Sodium methoxide solution?

sodium azide + methanol


How do you get sodium methoxide from sodium hydroxide and methanol?

NaOH + CH3OH --> CH3ONa + H2O Evaporate the solution to dryness, add more CH3OH and evaporate to dryness. you can repeat a few times to ensure the remaining solid is sodium methoxide


What is the equation reaction of 2-iodohexane with sodium methoxide?

The reaction between 2-iodohexane and sodium methoxide will result in an SN2 substitution reaction. The equation can be represented as: 2-iodohexane + Sodium methoxide → Hexane + Sodium iodide + Methanol


What happens if sodium methoxide 25 percent in methanol reacts with water?

The sodium methoxide reacts with the water to produce sodium hydroxide an methanol.


What would you expect to happen if sodium methoxide were added to water?

When sodium methoxide is added to water, it will undergo hydrolysis, producing sodium hydroxide and methanol. This reaction releases heat and sodium hydroxide is a strong base that can cause skin and eye irritation. Extreme care should be taken when handling sodium methoxide as it is highly reactive.


Why should sodium methoxide 25 percent in methanol be kept tightly closed when not in use?

Firstly, sodium methoxide is extremely toxic, so you want to handle it carefully without ever spilling (e.g. from an unsealed container). Secondly, methanol is hygroscopic and will pick up lots of water from the atmosphere. Water will hydrolyze sodium methoxide into methanol and sodium hydroxide. You wouldn't want your methanol to evaporate either.


How can one prepare a saturated sodium bicarbonate solution?

To prepare a saturated sodium bicarbonate solution, add sodium bicarbonate (baking soda) to water until no more can dissolve. This creates a solution where the maximum amount of sodium bicarbonate is dissolved in the water.


What is the equation of 2 iodohexane with sodium methoxide?

The reaction between 2-iodohexane and sodium methoxide will result in the substitution of the iodine atom by the methoxy group. The product formed will be 2-methoxyhexane. The equation for the reaction is 2-iodohexane + sodium methoxide -> 2-methoxyhexane + sodium iodide.


How does the reaction of 1-bromobutane with sodium methoxide predominantly result in elimination products?

The reaction of 1-bromobutane with sodium methoxide predominantly results in elimination products due to the strong base nature of sodium methoxide, which favors the E2 elimination mechanism over the SN2 substitution mechanism. This leads to the formation of alkenes as the major products.


Why use sodium chloride for medicine?

Sodium chloride is used to prepare the 0,9 % isotonic solution.


Would the alkoxide form if an hydroxide was dissolved in methanol?

No. Alkoxide ions are stronger bases than hydroxide ions. The only way of making an alkoxide is by reacting a hihgly reactive metal such as sodium with the corresponding alcohol (react sodium with methanol to produce sodium methoxide). In water sodium methoxide will react to produce sodium hydroxide and methanol.