answersLogoWhite

0

Pb (lead) and AlF3 (aluminum fluoride) can react under certain conditions, typically involving heat. Lead can displace aluminum from aluminum fluoride, forming lead fluoride (PbF2) and aluminum (Al). The reaction may proceed as follows: Pb + AlF3 → PbF2 + Al. However, this reaction is not commonly encountered in standard chemical practices.

User Avatar

AnswerBot

9mo ago

What else can I help you with?

Related Questions

Coding in c plus plus to swap two nos using pointer?

void swap (int &pa, int &pb) { *pa ^= *pb; *pb ^= *pa; *pa ^= *pb; }


How does Pb 2 plus become Pb 4 plus?

a peanut buter and jelly or jam sandwich


How do you balance Pbo plus C equals Pb plus CO2?

2 PbO + C -> 2 Pb + CO2


What is the chemical formula for aluminum fluoride?

The chemical formula for aluminum fluoride is AlF3.


What is the balanced equation for zinc plus lead nitrate yield zinc nitrate plus lead?

Equation is Zn + Pb(NO3)2 --> Zn(NO3)2 + Pb


How many moles of anions are in 33.4 g of AlF3?

molar mass AlF3 = 83.98 g/mole33.4 g AlF3 x 1 mole/83.98 g = 0.398 molesEach mole of AlF3 contains 3 moles of F- anions, because AlF3 ==> Al^3+ + 3F^-.Thus, moles of anions = 3 x 0.398 = 1.19 moles of anions


What is the correct chemical formula for aluminum fluoride?

The correct chemical formula for aluminum fluoride is AlF3.


What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?

NI(NO3)3+pbbr4nibr3+pb(no3)4


What is the correct cell notation for the redox reaction 3Pb2 plus aq plus 2Cr s 3Pb s plus 2Cr3 plus aq?

Cr(s) | Cr3+(aq) Pb2+(aq) | Pb(s)


How to balance Pb plus pbo2 plus h2so4 H2O plus pbso4?

To balance the chemical equation Pb + PbO2 + H2SO4 → H2O + PbSO4, start by balancing the Pb atoms on the left side by adding a coefficient of 2 in front of Pb on the left side. Then balance the SO4 atoms by adding a coefficient of 4 in front of H2SO4. The balanced equation is 2Pb + PbO2 + 4H2SO4 → 2H2O + 2PbSO4.


What is the ionic compound for AlF3?

The first symbol represnts the compound magnesium iodide (MgI2) and the second symbol represents aluminum fluoride (AlF3)


What is the total number of electrons in an Pb plus 4?

Pb which is neutral has 82 electrons. Thus, if it has a 4+ charge, then it has 78 electrons.