0
What is the balanced equation for the reaction of oleic acid and iodine?
Wiki User
∙ 9y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the chemical equation for reaction of bromine with oleic acid?
Bromine attacks triolein at three places where double bonds exist in the structure, causing saturated molecule. The equation for the reaction of triolein with bromine is C57 H104 06 + 3 Br2 --> C57 H104 06 Br6.
What would the simulation have shown if oleic acid was added to water?
Oleic acid is not miscible with water.
Why is a dilute solution of oleic acid used instead of pure oleic acid?
The text is asking why a solution of oleic acid that has been weakened with water is used instead of pure oleic acid. Oleic acid is a type of fatty acid commonly found in animal and vegetable fats and oils. Diluting the solution may be necessary for certain applications to achieve a desired concentration or to prevent adverse effects.
Why is the melting point of Palmitoleic acid lower than that of oleic acid?
because palmitoleic acid has less number of carbons than oleic acid
What is the difference between Oleic acid and Erucic acid?
Banana's
What is the chemical equation for reaction of bromine with oleic acid?
Bromine attacks triolein at three places where double bonds exist in the structure, causing saturated molecule. The equation for the reaction of triolein with bromine is C57 H104 06 + 3 Br2 --> C57 H104 06 Br6.
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
What would the simulation have shown if oleic acid was added to water?
Oleic acid is not miscible with water.
Is Oleic acid likely to be a liquid at room temperature?
Oleic acid at (30°C) the visocity is 25.6
Why is a dilute solution of oleic acid used instead of pure oleic acid?
The text is asking why a solution of oleic acid that has been weakened with water is used instead of pure oleic acid. Oleic acid is a type of fatty acid commonly found in animal and vegetable fats and oils. Diluting the solution may be necessary for certain applications to achieve a desired concentration or to prevent adverse effects.
What type of lipid is triolein?
Trioelein is a triglyceride. It is derived from glycerol and three units of the unsaturated and oleic acid. Oleic acid is a fatty acid.
What is the chemical formula of oleic acid?
C18H34O2
Is oleic acid a compound?
Oleic Acid is a Chemical Compound. It is an unsaturated fatty acid that is the most widely distributed and abundant fatty acid in nature.
Why is the melting point of Palmitoleic acid lower than that of oleic acid?
because palmitoleic acid has less number of carbons than oleic acid
What has the author Robert Frederick Peterson written?
Robert Frederick Peterson has written: 'The aralkylation, alkylation and acylation of oleic acid' -- subject(s): Oleic acid
How do you mix oleic acid with water?
emulsify it with propanol.
What acid is a body fat compound?
Oleic Acid
