How do you fold a piece of paper 10 times?
A piece of paper can be folded ten times by simply following the simple procedure in a simple way which is simply given below.
OR GO TO http://www.pomonahistorical.org/12times.htm FOR A NOT SWEAT SOLUTION
How binary is stored in a computer?
There are several codes. One of the older ones is the American Standard Code for Information Interchange (ASCII). It used a 7-bit code which permitted 128 characters. When that number was found to be inadequate the American Nation Standards Institute (ANSI) introduced an 8-bit version. Computers use ANSI code pages which are whole sets of ANSI codes. Then there are other systems like UNICODE.
Do you think horoscopes are true?
== == Have you ever read one and it happened?
* Yes, I have. It said that the day was not a good day to listen to music, and when I listened to music I about broke my wrist. * I do think they are true. When I read my monthly horoscope on Yahoo! Mail it came true and I was so happy--well, at least part of it came true!
What should i do on class 9th Disaster Management CBSE project?
make an instruction manual for the disasters you may have chances to appear in your local community and also prepare a list of preparedness and prevention program that can be done in your school..
This time ie class 9 the CBSE (NCERT) board of Delhi is giving us some projects which should be submitted in time by following the instruction given from the teachers which should consist of 30 pages within the given time on which we would be evaluted.
What number comes next in this pattern1 8 27 64 125?
its an exponential series. 3^0=1 3^1=3 3^2=9 3^3=27 3^4=81 3^5=X
more of how to solve it then the answer
[if your still stuck think of it as 81x3=X] in laymans terms 243, times it by 3 each time.
A diagonal separates the parallelogram into?
Two congruent triangles.. To prove it, use the SSS Postulate.
What dangerous things can happen if you don't take a shower in more than two weeks?
Probably Skin infection in the genitalia. Bacteria can built up and you get sick.
The numbers that are divisible by 8 are infinite. The first four are: 8, 16, 24, 32 . . .
What are the theorems and postulates you can use to prove triangles are congruent?
Pythagorean's Theorem is one of the most famous ones. It says that the two squared sides of a right triangle equal the squared side of the hypotenuse. In other words, a2 + b2 = c2
How many essentail parts does a two-column proof have?
At least one given, something in the middle [a transition], and the answer. There can be more than one given and more things in the middle.
Could you prove that 2 plus 2 equals 5?
Begin with the equation:
4Xn = 5Xn
Divide each side of the equation by n and you get
4=5
Therefore
2+2=5
What is the last number of the universe?
Google-Plex , a google is a 1 followed by 100 zeroes , a google-plex is a google followed by another 100 zeroes
What material is used to make a bulletproof vest?
In India Anjani Techno plast ltd, MKU kanpur (both are highly corrupted), Coolroc Hyderabad, TATA adv materials, Star wire India pvt Ltd etc are some companies who provide personal protection but quality is very poor :(
How do you proof the formula sin2A equals 2sinAcosA?
First, note that sin(a+b)=sin(a)cos(b)+sin(b)cos(a)
[For a proof, see: www.mathsroom.co.uk/downloads/Compound_Angle_Proof.ppt
For the case of b=a, we have:
sin (a+a)=sin(a)cos(a)+sin(a)cos(a)
sin (2a)=2*sin(a)cos(a)
What is the difference between conditional and unconditional?
Conditional is acquired during life. It is highly individual and specially learned. It involves Cortical or higher subcortical centers. It makes reflexes more precise and individual. It is corresponding to the conditions we live in.
An unconditional reflex is inborn, the mechanism is already present and ready. It is realized from different parts of the Central Nervous System usually not involving the Cortex. It is steady and characteristic and common in a species. It serves for self-preservation (e.g. foot intake), self-development (for instance imitation or research) and as species maintained social (sexual behavior, hierarchy, territorial, relation to parent).
Why does the computer use the binary number system?
A computer can only distinguish between two states: on and off. So it can only use two numbers.
Because the first computer consisted of rows of switches which were either on - or off. The binary number system uses a 1 and 0 in place of the on and off functions.
Hello,
The computer uses the binary system because the information in a computer is actually electrical pulses (on/off) And because of that we use 0 (off) and 1 (on) to make it easier for us to calculate it :)
Actually, we don't really have a choice in using the binary system. Computers are electrical machines, so we are pretty much forced to use it as the lowest level of communication. Then past that there's hexadecimal, then plain text.
the computer uses binary number system because the computer can understanding the binary language that is (0,1),and data which are entered by the input device the computer can convert each word into binary number that is (0,1)and then it process the data and again convert into machine language(binary language) to high level language and then we can saw and understand the output result.
Binary is used in all computers because at the hardware level everything is simply on or off, 1 or 0. With only two possible symbols to physically represent, binary systems are extremely simple to implement, whether through mechanical means or through electro-chemical means: a switch is either on or off; a capacitor either holds enough electrical charge or it does not; polarised material is either positively charged or it is negatively charged; a punch card either has a hole at a specific location or it does not. Any medium that can easily differentiate between two possible states can therefore be used to store and retrieve digital data. The simpler the data representation is to implement, the faster the machine will operate. And there simply is no numbering system any simpler than binary.
You can represent 0 and 1 with a simple change of state--on or off. And they can be used to convey the most complex data.
Here's an example. Imagine you have a little box with 4 buttons on it. These are the buttons:
1
2
4
8
If you press a button, it equals that number. If you don't press the button, it equals 0. If you press more than one button, they're added together.
Now look what happens if you press the buttons in different combinations:
no presses = 0
press 1 only, total = 1
press 2 only, total = 2
press 1 + 2, total = 3
press 4 only, total = 4
press 1 + 4, total = 5
press 2 + 4, total = 6
press 1 + 2 + 4, total = 7
press 8, total = 8
press 1 + 8, total = 9
And that is exactly how one "byte" (which contains 8 "bits," each of which can just be on or off) expresses the digits from 0 to 9. And so you can make any number, any number at all, because all numbers consist of the digits from 0 to 9. And you can add, subtract, multiply, divide, and more by turning those buttons or switches on and off.
It gets a little more complicated with letters and special characters (all the symbols you can type that aren't letters and numbers), but the principle is the same.
Along with the data, though, you have to make rules for interpreting it. For instance, you have to make a rule that says the first bit is worth 1, the second 2, and so on. And there are very elaborate rules for how the computer receives, translates, and returns all kinds of data. Those rules are definitions and programs. It even has to have rules for making definitions and programs, and those rules add up to what we call a "language."
You see what we can do with computers. If you're old enough to have watched the possibilities grow over the decades, you are probably more amazed than if you have just grown up with it. And we are really only just beginning. What we have now is still very primitive.
Those 0's and 1's (which we call "binary" and which we can use to mean on/off or yes/no) are incredibly powerful when you combine them with logical reasoning.
Axioms within the system, definitions, theorems "already proven" (not relying upon this theorem directly or indirectly for truth), and logic.
How computers use binary codes?
Computers have zero IQ. Computer can understand or feel "High voltage" or "Low voltage" or you can say, on and off. Computers use '0' for low voltage and '1' for high voltage. by using the conbinations of '0' and '1' all numbers and characters are classified. for example- if you have to write 'A', It is represented in ASCII code assigned to it and then converted to binary, hence use it.
What is the largest number on Earth?
There is no largest number. One simple way to consider this is to look at the function:
f(x) = x + 1
Pick any number, and plug it into that function. No matter what number you plug in, the function will always give you a number that is one larger than the previous one. It doesn't matter how big "x" is, there will always be an "x + 1" value, which will always be larger than x. This is a concept we refer to as infinity, which is usually represented with the symbol ∞. It is important to note that infinity is not in itself a number, but the concept of a set of numbers that has no limit.
There is however a large finite named number. That would be a googolplexian, which is a one followed by a googolplex of zeroes. A googolplex itself is a one followed by a googol of zeroes, and a googol is a one followed by a hundred zeroes. In other words:
1 googol = 1 × 10100
1 googolplex = 1 × 10googol or 1 x 10^(10^100)
1 googolplexian = 1 × 10googolplex or 1 x 10^(10^(10^100))
There are also large numbers that can only be expressed as complex exponentials, such as Graham's Number. Once again though, none of these are the largest number that exists, as there is no such thing. You need merely to add another value on top to reach a larger number.
5000 keystrokes equals how many Words per minute?
it depends on how long it takes to type 5000 keystrokes.
Prove that negative of an irrational number is an irrational number?
Assume = a/b with positive integers a und b. Now, for some natural number n define the functions f and F as follows. Strictly speaking, f and F should each have n as an index as they depend on n but this would render things unreadable; remember that n is always the same constant throughout this proof. Let f(x) = xn(a-bx)n/n! and let F(x) = f(x) + ... + (-1)jf(2j)(x) + ... + (-1)nf(2n)(x) where f(2j) denotes the 2j-th derivative of f. Then f and F have the following properties: f is a polynomial with coefficients that are integer, except for a factor of 1/n! f(x) = f(-x) 0
How would you work out the total surface area of a cube or a cuboid?