answersLogoWhite

0

🧪

Biochemistry

Biochemistry is the study of the structure, composition and chemical processes in all living organisms. It covers the structures and functions of various cellular components, including proteins, carbohydrates, nucleic acids, lipids, and other biomolecules.

8,065 Questions

Can activity in an enzyme be increased by a vitamin?

Yes, activity in an enzyme can be increased by a vitamin, particularly if the vitamin acts as a coenzyme or cofactor. Many vitamins, such as B vitamins, play crucial roles in metabolic processes by assisting enzymes in catalyzing reactions more efficiently. When vitamins are present, they can enhance the enzyme's activity, leading to improved biochemical reactions within the body.

What is the difference between monosaccharide disaccharide and polysaccharide?

Monosaccharides are the simplest form of carbohydrates, consisting of single sugar molecules like glucose and fructose. Disaccharides are formed by the combination of two monosaccharides through a glycosidic bond, examples being sucrose (table sugar) and lactose. Polysaccharides are complex carbohydrates made up of long chains of monosaccharide units, such as starch, glycogen, and cellulose, serving various functions like energy storage and structural support. The primary difference lies in their structure and complexity, with monosaccharides being single units, disaccharides being two, and polysaccharides being many.

What temperature does albumen denature at?

Albumen, or egg white, begins to denature at around 60°C (140°F) and continues to firm up as the temperature increases. Complete denaturation usually occurs at temperatures above 70°C (158°F). The process involves the unfolding of proteins, leading to changes in texture and appearance. This is why cooking eggs results in a solid, opaque consistency.

How do you put cells molecules tissue organs in right order?

Cells are the basic building blocks of life and come together to form tissues. Multiple tissues then combine to create organs, which perform specific functions in the body. Finally, organs work together as part of organ systems to maintain overall health and functionality. Thus, the correct order is: cells, tissues, organs.

What allele frequency in a population do not change or the population does not evolve?

In a population where allele frequencies do not change, it is said to be in Hardy-Weinberg equilibrium. This condition occurs when certain criteria are met: the population is large, mating is random, there are no mutations, no gene flow (migration), and no natural selection. Under these circumstances, the genetic variation remains stable over generations, indicating that the population is not evolving.

When does implantation occur and the Zygote develop?

Implantation occurs approximately 6 to 10 days after fertilization, when the fertilized egg, now called a blastocyst, attaches to the uterine lining. Following implantation, the zygote transitions into an embryo and begins to develop. This early stage is crucial for establishing the connection between the embryo and the mother's blood supply, enabling further growth and development.

Why the immune system would be able to distinguish animal insulin from human insulin.?

The immune system can distinguish animal insulin from human insulin due to differences in their amino acid sequences. While insulin from different species is quite similar, even small variations can be recognized by the immune system's antibodies and T-cells, which are trained to identify foreign proteins. This recognition can lead to an immune response, making animal insulin less effective or potentially triggering allergic reactions in humans.

Why is a strong acid used in seliwanoff's test?

A strong acid is used in Seliwanoff's test to facilitate the dehydration of carbohydrates, specifically distinguishing between aldoses and ketoses. The acid catalyzes the reaction, leading to the formation of furfural derivatives from ketoses, which then react with the phenol present in the test to produce a colored complex. This color change, typically a deep cherry red for ketoses, indicates a positive result, allowing for the differentiation of sugars. In contrast, aldoses do not react as quickly, resulting in a different color or no color change.

How does vitamin B6 help detox?

Vitamin B6 plays a crucial role in detoxification by aiding in the metabolism of amino acids and the synthesis of neurotransmitters. It supports the liver's function, which is essential for processing and eliminating toxins from the body. Additionally, B6 is involved in the production of glutathione, a powerful antioxidant that helps neutralize harmful substances and protect cells from oxidative stress. Overall, adequate levels of vitamin B6 contribute to a more efficient detoxification process.

What is the Nutrition label mount royal light whiskey?

Mount Royal Light Whiskey typically features a nutrition label that highlights its alcohol content, which is usually around 40% ABV (80 proof). While whiskey does not contain significant amounts of carbohydrates, fat, or protein, it is important to note that it has calories primarily derived from alcohol. A standard serving (1.5 oz) of whiskey generally contains about 97 calories. For specific nutritional information, it's best to refer to the product label or the manufacturer's website.

Scientists believe that all eukaryotes share a common ancestry because the nucleotides that make up all eukaryotic DNA are?

Scientists believe that all eukaryotes share a common ancestry because the nucleotides that compose their DNA are fundamentally similar in structure and sequence. This genetic uniformity suggests a shared evolutionary origin. Additionally, the presence of similar cellular structures and processes, such as membrane-bound organelles and complex regulatory mechanisms, further supports the idea of a common ancestor among eukaryotes. Overall, these genetic and structural similarities provide strong evidence for their shared lineage.

Name three saturated and three unsaturated fatty acids?

Fatty Acids are the name we use to give Carboxylic Acids with long hydrocarbon chains.

These hydrocarbon chains can contain one or more double bonds, which we can refer to the Fatty Acid as being unsaturated.

Saturated fatty acids are simple long chains.

Some Examples:

Saturated

  • Stearic Acid - CH3(CH2)16COOH
  • Lauric Acid - CH3(CH2)10COOH
  • Arachidic Acid - CH3(CH2)18COOH

Unsaturated

  • Oleic Acid - CH3(CH2)7CH=CH(CH2)7COOH
  • Erucic Acid - CH3(CH2)7CH=CH(CH2)11COOH
  • Palmitoleic Acid - CH3(CH2)5CH=CH(CH2)7COOH

Starch and cellulose are polysaccharides but you can eat or digest starch and not the cellulose why?

Both starch and cellulose are polymers of glucose. However, the individual glucose units are linked differently in the two. Humans have an enzyme which is capable of breaking the linkages used to form starch, but do not have one that can break the linkage used to form cellulose. (If you want the technical terms, cellulose uses a beta(1-4) link and starch uses both alpha(1-4) and alpha(1-6) links.)

What are the Three components of a DNA molecule?

A sugar (deoxyribose), a phosphate group, and a nitrogenous base (adenine, thymine, cytosine or guanine).

P, O, C, N, H, (and some associated metal ions, though not technically necessary to make up DNA).

How much vitamin c you need to take with glutathione to whiten my skin?

To achieve effective skin whitening, Glutathione should be combined with Vitamin C in the right dosage. They both work synergistically. Research suggests that Vitamin C enhances Glutathione levels in the body by helping to regenerate it and preventing its oxidation. According to dermatological research, 400mg to 500mg per day glutathione is good for the skin

For the best results, consider GLO-C Best Skin Whitening Pills. It contains 500mg of Glutathione and 100mg of Vitamin C, along with Alpha Lipoic Acid, which enhances the absorption Regular use can help improve skin tone, reduce pigmentation, and provide anti-aging benefits.

Is milk soluble in water?

Milk is mostly water, which is very polar. Sugar (sucrose) is also a rather polar molecule. So, polar compounds dissolve readily in polar solvents. That is why sugar easily dissolves in milk.

Are organic compounds flammable or combustible?

All the organic compounds contain carbon but the most stable compound of carbon is carbon dioxide (and finally carbonate) on combustion carbon of organic compound is converted into carbon dioxide to gain the stability therefore organic compounds are inflammable.

What elements combine to make sand?

Well, darling, sand is made up of tiny little pieces of rock and mineral particles. These particles can come from a variety of sources, like quartz, feldspar, and even seashells. Mix it all together and voilà, you've got yourself some gritty goodness known as sand.

What is stearamide amp?

Stearamide AMP, CAS (Chemical Abstract Service) Registry Numbers 36284-86-3 or 68951-62-2, is the amide formed from the reaction of stearic acid (typically triple-pressed grade, meaning it is actually about equal parts palmitic acid and stearic acid) and 2-amino-2-methyl-1-propanol. It is therefore an alkanolamide, and is used in personal care cleansing compositions as a foam booster and viscosity increasing agent. In commerce it is most commonly sold as a mixture with other components, such as glycol stearate (an ester used to impart a pearlescent appearance to water-based personal cleansing compositions).

Why does catalase elute in a wider range of fractions than glucose oxidase does?

Catalase degrades easily at room temperature b. Glucose oxidase is inactivated at low pH c. Glucose oxidase is only active at low pH d. Glucose oxidase has a higher molecular weight than catalase .

Can iodine change the color of a protein?

If it does not interact with chlorophyll, it will remain brown. If it interacts with chlorophyll, it turns blue-black.

The color in solutions depends on the solvent - the ethanolic solution is brown.

In simple terms what is polyethylene glycol made of?

Polyethylene glycol is a polymer composed of the elements carbon (C), hydrogen (H), and oxygen (O). It is called a polymer because it is a huge molecule with thousands of atoms, composed of a long chain of bonded atoms. The pattern in the atoms repeats itself. The pattern is:
HO-(CH2-CH2-O)n-H
where the part in the middle in parenthesis repeats itself over and over again. For example, if it only repeated itself 3 times, it would be:

HO-CH2-CH2-O-CH2-CH2-O-CH2-CH2-O-H
In the real molecule, it repeats itself many more times than that!

See the Web Links and Related Questions for more information.

Is glucose aliphatic or aromatic?

Glucose is considered aliphatic because it is a simple sugar composed of a straight-chain carbon skeleton, specifically a hexose with a six-carbon chain. Aromatic compounds, on the other hand, have ring structures containing delocalized electrons, which glucose does not possess.

What would happen without photosynthesis?

If light was to suddenly stop, photosynthesis would stop. The driving energy behind photosynthesis is chemical energy which is created directly from sunlight. Without photosynthesis a build up of carbon would occur and humans and animals would come to and end.